C22H21O2P — CID 174367673
oxophosphane;(2-phenylphenyl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 174367673) has the molecular formula C22H21O2P and a molecular weight of 348.38 g/mol. Its IUPAC name is oxophosphane;(2-phenylphenyl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | oxophosphane;(2-phenylphenyl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 174367673 |
| Molecular Formula | C22H21O2P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | oxophosphane;(2-phenylphenyl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2-c2ccccc2)c(C)c1.O=P |
| InChI | InChI=1S/C22H20O.HOP/c1-15-13-16(2)21(17(3)14-15)22(23)20-12-8-7-11-19(20)18-9-5-4-6-10-18;1-2/h4-14H,1-3H3;2H |
| InChIKey | FZDYHXQJPDSASV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|