C48H45O4P — CID 172706516
[[2,3-bis(2,4,6-trimethylbenzoyl)phenyl]-(2,3,4-trimethyl-5-phenylphenyl)phosphoryl]-phenylmethanone (PubChem CID 172706516) has the molecular formula C48H45O4P and a molecular weight of 716.86 g/mol. Its IUPAC name is [[2,3-bis(2,4,6-trimethylbenzoyl)phenyl]-(2,3,4-trimethyl-5-phenylphenyl)phosphoryl]-phenylmethanone.
| Compound Name | [[2,3-bis(2,4,6-trimethylbenzoyl)phenyl]-(2,3,4-trimethyl-5-phenylphenyl)phosphoryl]-phenylmethanone |
|---|---|
| PubChem CID | 172706516 |
| Molecular Formula | C48H45O4P |
| Molecular Weight | 716.86 g/mol |
| Exact Mass | 716.31 |
| IUPAC Name | [[2,3-bis(2,4,6-trimethylbenzoyl)phenyl]-(2,3,4-trimethyl-5-phenylphenyl)phosphoryl]-phenylmethanone |
| SMILES | Cc1cc(C)c(C(=O)c2cccc(P(=O)(C(=O)c3ccccc3)c3cc(-c4ccccc4)c(C)c(C)c3C)c2C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C48H45O4P/c1-28-23-30(3)43(31(4)24-28)46(49)39-21-16-22-41(45(39)47(50)44-32(5)25-29(2)26-33(44)6)53(52,48(51)38-19-14-11-15-20-38)42-27-40(35(8)34(7)36(42)9)37-17-12-10-13-18-37/h10-27H,1-9H3 |
| InChIKey | DQUJXZWGIXDGOE-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.86 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|