C40H36O6P2 — CID 21343895
[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]-[2-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methanone (PubChem CID 21343895) has the molecular formula C40H36O6P2 and a molecular weight of 674.67 g/mol. Its IUPAC name is [phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]-[2-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methanone.
| Compound Name | [phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]-[2-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methanone |
|---|---|
| PubChem CID | 21343895 |
| Molecular Formula | C40H36O6P2 |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | [phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]-[2-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(C(=O)c2ccccc2C(=O)P(=O)(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C40H36O6P2/c1-25-21-27(3)35(28(4)22-25)39(43)47(45,31-15-9-7-10-16-31)37(41)33-19-13-14-20-34(33)38(42)48(46,32-17-11-8-12-18-32)40(44)36-29(5)23-26(2)24-30(36)6/h7-24H,1-6H3 |
| InChIKey | AKTNCNRVKPFETG-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|