C30H31O3PS4 — CID 158535793
[4-[[4-(ethanethioylsulfanylmethyl)-2,6-dimethylbenzoyl]-phenylphosphoryl]carbonyl-3,5-dimethylphenyl]methyl ethanedithioate (PubChem CID 158535793) has the molecular formula C30H31O3PS4 and a molecular weight of 598.82 g/mol. Its IUPAC name is [4-[[4-(ethanethioylsulfanylmethyl)-2,6-dimethylbenzoyl]-phenylphosphoryl]carbonyl-3,5-dimethylphenyl]methyl ethanedithioate.
| Compound Name | [4-[[4-(ethanethioylsulfanylmethyl)-2,6-dimethylbenzoyl]-phenylphosphoryl]carbonyl-3,5-dimethylphenyl]methyl ethanedithioate |
|---|---|
| PubChem CID | 158535793 |
| Molecular Formula | C30H31O3PS4 |
| Molecular Weight | 598.82 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | [4-[[4-(ethanethioylsulfanylmethyl)-2,6-dimethylbenzoyl]-phenylphosphoryl]carbonyl-3,5-dimethylphenyl]methyl ethanedithioate |
| SMILES | CC(=S)SCc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(CSC(C)=S)cc2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C30H31O3PS4/c1-18-12-24(16-37-22(5)35)13-19(2)27(18)29(31)34(33,26-10-8-7-9-11-26)30(32)28-20(3)14-25(15-21(28)4)17-38-23(6)36/h7-15H,16-17H2,1-6H3 |
| InChIKey | ZUSVVUXFCCTQOI-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.82 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|