C28H28ClO4P — CID 140903554
2-chloro-1-[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]ethanone (PubChem CID 140903554) has the molecular formula C28H28ClO4P and a molecular weight of 494.96 g/mol. Its IUPAC name is 2-chloro-1-[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]ethanone.
| Compound Name | 2-chloro-1-[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]ethanone |
|---|---|
| PubChem CID | 140903554 |
| Molecular Formula | C28H28ClO4P |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-chloro-1-[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]ethanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)c(C(=O)CCl)c2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H28ClO4P/c1-16-12-17(2)24(18(3)13-16)27(31)34(33,22-10-8-7-9-11-22)28(32)26-20(5)14-19(4)25(21(26)6)23(30)15-29/h7-14H,15H2,1-6H3 |
| InChIKey | AOPGGSRFVPXEMI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|