C53H54O6P2 — CID 123284449
[phenyl-[2,4,6-trimethyl-3-[[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl]benzoyl]phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 123284449) has the molecular formula C53H54O6P2 and a molecular weight of 848.96 g/mol. Its IUPAC name is [phenyl-[2,4,6-trimethyl-3-[[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl]benzoyl]phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [phenyl-[2,4,6-trimethyl-3-[[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl]benzoyl]phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 123284449 |
| Molecular Formula | C53H54O6P2 |
| Molecular Weight | 848.96 g/mol |
| Exact Mass | 848.34 |
| IUPAC Name | [phenyl-[2,4,6-trimethyl-3-[[2,4,6-trimethyl-3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl]benzoyl]phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)c(Cc3c(C)cc(C)c(C(=O)P(=O)(C(=O)c4c(C)cc(C)cc4C)c4ccccc4)c3C)c2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C53H54O6P2/c1-30-23-34(5)46(35(6)24-30)50(54)60(58,42-19-15-13-16-20-42)52(56)48-38(9)27-32(3)44(40(48)11)29-45-33(4)28-39(10)49(41(45)12)53(57)61(59,43-21-17-14-18-22-43)51(55)47-36(7)25-31(2)26-37(47)8/h13-28H,29H2,1-12H3 |
| InChIKey | FUZLQYQSIBSUFB-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.96 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|