C22H22O3P2 — CID 118610994
diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;oxophosphane (PubChem CID 118610994) has the molecular formula C22H22O3P2 and a molecular weight of 396.36 g/mol. Its IUPAC name is diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;oxophosphane.
| Compound Name | diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;oxophosphane |
|---|---|
| PubChem CID | 118610994 |
| Molecular Formula | C22H22O3P2 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone;oxophosphane |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1.O=P |
| InChI | InChI=1S/C22H21O2P.HOP/c1-16-14-17(2)21(18(3)15-16)22(23)25(24,19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-2/h4-15H,1-3H3;2H |
| InChIKey | ALKDRCGHORMULG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|