C25H23O4P — CID 118231450
(2-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate (PubChem CID 118231450) has the molecular formula C25H23O4P and a molecular weight of 418.43 g/mol. Its IUPAC name is (2-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate.
| Compound Name | (2-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 118231450 |
| Molecular Formula | C25H23O4P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (2-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(C)cc(C)c1C(=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23O4P/c1-4-23(26)29-17-20-16-18(2)15-19(3)24(20)25(27)30(28,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h4-16H,1,17H2,2-3H3 |
| InChIKey | YQRYURGDKVPUNP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|