C20H23O3P — CID 58752978
[2-ethenoxyethyl(phenyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 58752978) has the molecular formula C20H23O3P and a molecular weight of 342.38 g/mol. Its IUPAC name is [2-ethenoxyethyl(phenyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [2-ethenoxyethyl(phenyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 58752978 |
| Molecular Formula | C20H23O3P |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [2-ethenoxyethyl(phenyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | C=COCCP(=O)(C(=O)c1c(C)cc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C20H23O3P/c1-5-23-11-12-24(22,18-9-7-6-8-10-18)20(21)19-16(3)13-15(2)14-17(19)4/h5-10,13-14H,1,11-12H2,2-4H3 |
| InChIKey | VFUDQUJVWBCUIY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|