C24H31O4P — CID 151707072
3-methylbutyl 3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]propanoate (PubChem CID 151707072) has the molecular formula C24H31O4P and a molecular weight of 414.48 g/mol. Its IUPAC name is 3-methylbutyl 3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]propanoate.
| Compound Name | 3-methylbutyl 3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]propanoate |
|---|---|
| PubChem CID | 151707072 |
| Molecular Formula | C24H31O4P |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-methylbutyl 3-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]propanoate |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CCC(=O)OCCC(C)C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H31O4P/c1-17(2)11-13-28-22(25)12-14-29(27,21-9-7-6-8-10-21)24(26)23-19(4)15-18(3)16-20(23)5/h6-10,15-17H,11-14H2,1-5H3 |
| InChIKey | RFUMRXQCTGUSRV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|