C31H35O5P — CID 140521280
3-phenylpropyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate (PubChem CID 140521280) has the molecular formula C31H35O5P and a molecular weight of 518.59 g/mol. Its IUPAC name is 3-phenylpropyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate.
| Compound Name | 3-phenylpropyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate |
|---|---|
| PubChem CID | 140521280 |
| Molecular Formula | C31H35O5P |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 3-phenylpropyl 2-bis(2,4,6-trimethylbenzoyl)phosphorylacetate |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CC(=O)OCCCc2ccccc2)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C31H35O5P/c1-20-15-22(3)28(23(4)16-20)30(33)37(35,31(34)29-24(5)17-21(2)18-25(29)6)19-27(32)36-14-10-13-26-11-8-7-9-12-26/h7-9,11-12,15-18H,10,13-14,19H2,1-6H3 |
| InChIKey | XTWOFNDGJONVRY-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|