C24H23O4P — CID 151111199
benzyl 2-[(2,6-dimethylbenzoyl)-phenylphosphoryl]acetate (PubChem CID 151111199) has the molecular formula C24H23O4P and a molecular weight of 406.42 g/mol. Its IUPAC name is benzyl 2-[(2,6-dimethylbenzoyl)-phenylphosphoryl]acetate.
| Compound Name | benzyl 2-[(2,6-dimethylbenzoyl)-phenylphosphoryl]acetate |
|---|---|
| PubChem CID | 151111199 |
| Molecular Formula | C24H23O4P |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | benzyl 2-[(2,6-dimethylbenzoyl)-phenylphosphoryl]acetate |
| SMILES | Cc1cccc(C)c1C(=O)P(=O)(CC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23O4P/c1-18-10-9-11-19(2)23(18)24(26)29(27,21-14-7-4-8-15-21)17-22(25)28-16-20-12-5-3-6-13-20/h3-15H,16-17H2,1-2H3 |
| InChIKey | MQDZITCMWLQXQQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|