C21H24ClO5P — CID 172720574
pentyl 2-[(2-chloro-6-methoxybenzoyl)-phenylphosphoryl]acetate (PubChem CID 172720574) has the molecular formula C21H24ClO5P and a molecular weight of 422.85 g/mol. Its IUPAC name is pentyl 2-[(2-chloro-6-methoxybenzoyl)-phenylphosphoryl]acetate.
| Compound Name | pentyl 2-[(2-chloro-6-methoxybenzoyl)-phenylphosphoryl]acetate |
|---|---|
| PubChem CID | 172720574 |
| Molecular Formula | C21H24ClO5P |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | pentyl 2-[(2-chloro-6-methoxybenzoyl)-phenylphosphoryl]acetate |
| SMILES | CCCCCOC(=O)CP(=O)(C(=O)c1c(Cl)cccc1OC)c1ccccc1 |
| InChI | InChI=1S/C21H24ClO5P/c1-3-4-8-14-27-19(23)15-28(25,16-10-6-5-7-11-16)21(24)20-17(22)12-9-13-18(20)26-2/h5-7,9-13H,3-4,8,14-15H2,1-2H3 |
| InChIKey | GLPRJTGTYBKTOS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|