C21H27O5P — CID 18514103
[pentyl(phenyl)phosphoryl]-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 18514103) has the molecular formula C21H27O5P and a molecular weight of 390.42 g/mol. Its IUPAC name is [pentyl(phenyl)phosphoryl]-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | [pentyl(phenyl)phosphoryl]-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18514103 |
| Molecular Formula | C21H27O5P |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [pentyl(phenyl)phosphoryl]-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | CCCCCP(=O)(C(=O)c1c(OC)cc(OC)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C21H27O5P/c1-5-6-10-13-27(23,17-11-8-7-9-12-17)21(22)20-18(25-3)14-16(24-2)15-19(20)26-4/h7-9,11-12,14-15H,5-6,10,13H2,1-4H3 |
| InChIKey | OQZVETPQDKZPRS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|