C17H18ClO3P — CID 18514206
(2-chloro-6-methoxyphenyl)-[phenyl(propyl)phosphoryl]methanone (PubChem CID 18514206) has the molecular formula C17H18ClO3P and a molecular weight of 336.75 g/mol. Its IUPAC name is (2-chloro-6-methoxyphenyl)-[phenyl(propyl)phosphoryl]methanone.
| Compound Name | (2-chloro-6-methoxyphenyl)-[phenyl(propyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 18514206 |
| Molecular Formula | C17H18ClO3P |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (2-chloro-6-methoxyphenyl)-[phenyl(propyl)phosphoryl]methanone |
| SMILES | CCCP(=O)(C(=O)c1c(Cl)cccc1OC)c1ccccc1 |
| InChI | InChI=1S/C17H18ClO3P/c1-3-12-22(20,13-8-5-4-6-9-13)17(19)16-14(18)10-7-11-15(16)21-2/h4-11H,3,12H2,1-2H3 |
| InChIKey | UONHYMWOHOWIIN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|