C24H21Cl2O7P — CID 159912845
[(2,6-dichlorophenyl)-(2,6-dimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 159912845) has the molecular formula C24H21Cl2O7P and a molecular weight of 523.31 g/mol. Its IUPAC name is [(2,6-dichlorophenyl)-(2,6-dimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [(2,6-dichlorophenyl)-(2,6-dimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 159912845 |
| Molecular Formula | C24H21Cl2O7P |
| Molecular Weight | 523.31 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | [(2,6-dichlorophenyl)-(2,6-dimethoxybenzoyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)P(=O)(C(=O)c1c(OC)cccc1OC)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H21Cl2O7P/c1-30-16-10-6-11-17(31-2)20(16)23(27)34(29,22-14(25)8-5-9-15(22)26)24(28)21-18(32-3)12-7-13-19(21)33-4/h5-13H,1-4H3 |
| InChIKey | NXJZYEGYNJOCEG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.31 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|