C15H13Cl2NO3 — CID 3653582
N-(2,6-dichlorophenyl)-2,6-dimethoxybenzamide (PubChem CID 3653582) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2,6-dimethoxybenzamide.
| Compound Name | N-(2,6-dichlorophenyl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 3653582 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H13Cl2NO3/c1-20-11-7-4-8-12(21-2)13(11)15(19)18-14-9(16)5-3-6-10(14)17/h3-8H,1-2H3,(H,18,19) |
| InChIKey | YVNDPQKOSAIVGR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |