C16H15Cl2NO4 — CID 2347602
N-(2,6-dichlorophenyl)-2,3,4-trimethoxybenzamide (PubChem CID 2347602) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(2,6-dichlorophenyl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 2347602 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cccc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C16H15Cl2NO4/c1-21-12-8-7-9(14(22-2)15(12)23-3)16(20)19-13-10(17)5-4-6-11(13)18/h4-8H,1-3H3,(H,19,20) |
| InChIKey | GIIPDJLSYMTCNF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |