C16H13Cl2NO5 — CID 2800092
(2,6-dichlorophenyl) N-(2,6-dimethoxybenzoyl)carbamate (PubChem CID 2800092) has the molecular formula C16H13Cl2NO5 and a molecular weight of 370.19 g/mol. Its IUPAC name is (2,6-dichlorophenyl) N-(2,6-dimethoxybenzoyl)carbamate.
| Compound Name | (2,6-dichlorophenyl) N-(2,6-dimethoxybenzoyl)carbamate |
|---|---|
| PubChem CID | 2800092 |
| Molecular Formula | C16H13Cl2NO5 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (2,6-dichlorophenyl) N-(2,6-dimethoxybenzoyl)carbamate |
| SMILES | COc1cccc(OC)c1C(=O)NC(=O)Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO5/c1-22-11-7-4-8-12(23-2)13(11)15(20)19-16(21)24-14-9(17)5-3-6-10(14)18/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | OWOUOIBXRBXTJL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |