C27H27O9PS — CID 54513060
bis(2,6-dimethoxybenzoyl)phosphinothioyl-(2,6-dimethoxyphenyl)methanone (PubChem CID 54513060) has the molecular formula C27H27O9PS and a molecular weight of 558.55 g/mol. Its IUPAC name is bis(2,6-dimethoxybenzoyl)phosphinothioyl-(2,6-dimethoxyphenyl)methanone.
| Compound Name | bis(2,6-dimethoxybenzoyl)phosphinothioyl-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 54513060 |
| Molecular Formula | C27H27O9PS |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | bis(2,6-dimethoxybenzoyl)phosphinothioyl-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)P(=S)(C(=O)c1c(OC)cccc1OC)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C27H27O9PS/c1-31-16-10-7-11-17(32-2)22(16)25(28)37(38,26(29)23-18(33-3)12-8-13-19(23)34-4)27(30)24-20(35-5)14-9-15-21(24)36-6/h7-15H,1-6H3 |
| InChIKey | YKMPHKXVIAHNEN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|