C24H22ClO6P — CID 70015697
(2-chloro-6-methoxyphenyl)-[(2,6-dimethoxy-4-methylbenzoyl)-phenylphosphoryl]methanone (PubChem CID 70015697) has the molecular formula C24H22ClO6P and a molecular weight of 472.86 g/mol. Its IUPAC name is (2-chloro-6-methoxyphenyl)-[(2,6-dimethoxy-4-methylbenzoyl)-phenylphosphoryl]methanone.
| Compound Name | (2-chloro-6-methoxyphenyl)-[(2,6-dimethoxy-4-methylbenzoyl)-phenylphosphoryl]methanone |
|---|---|
| PubChem CID | 70015697 |
| Molecular Formula | C24H22ClO6P |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (2-chloro-6-methoxyphenyl)-[(2,6-dimethoxy-4-methylbenzoyl)-phenylphosphoryl]methanone |
| SMILES | COc1cccc(Cl)c1C(=O)P(=O)(C(=O)c1c(OC)cc(C)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C24H22ClO6P/c1-15-13-19(30-3)22(20(14-15)31-4)24(27)32(28,16-9-6-5-7-10-16)23(26)21-17(25)11-8-12-18(21)29-2/h5-14H,1-4H3 |
| InChIKey | GDYIFFXDQDWVNE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|