C25H24ClO7P — CID 123711505
[[3-(chloromethyl)-2,6-dimethoxybenzoyl]-phenylphosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 123711505) has the molecular formula C25H24ClO7P and a molecular weight of 502.89 g/mol. Its IUPAC name is [[3-(chloromethyl)-2,6-dimethoxybenzoyl]-phenylphosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [[3-(chloromethyl)-2,6-dimethoxybenzoyl]-phenylphosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 123711505 |
| Molecular Formula | C25H24ClO7P |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | [[3-(chloromethyl)-2,6-dimethoxybenzoyl]-phenylphosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)P(=O)(C(=O)c1c(OC)ccc(CCl)c1OC)c1ccccc1 |
| InChI | InChI=1S/C25H24ClO7P/c1-30-18-11-8-12-19(31-2)21(18)24(27)34(29,17-9-6-5-7-10-17)25(28)22-20(32-3)14-13-16(15-26)23(22)33-4/h5-14H,15H2,1-4H3 |
| InChIKey | XKVUKEKZJFURGE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|