C21H19O4P — CID 150140511
[(2,3-dimethoxyphenyl)-phenylphosphoryl]-phenylmethanone (PubChem CID 150140511) has the molecular formula C21H19O4P and a molecular weight of 366.35 g/mol. Its IUPAC name is [(2,3-dimethoxyphenyl)-phenylphosphoryl]-phenylmethanone.
| Compound Name | [(2,3-dimethoxyphenyl)-phenylphosphoryl]-phenylmethanone |
|---|---|
| PubChem CID | 150140511 |
| Molecular Formula | C21H19O4P |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(2,3-dimethoxyphenyl)-phenylphosphoryl]-phenylmethanone |
| SMILES | COc1cccc(P(=O)(C(=O)c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C21H19O4P/c1-24-18-14-9-15-19(20(18)25-2)26(23,17-12-7-4-8-13-17)21(22)16-10-5-3-6-11-16/h3-15H,1-2H3 |
| InChIKey | FDEKDRUTHQDBHA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|