C46H36O4P2 — CID 46939365
1-[[3-methoxy-2-[2-methoxy-6-[naphthalen-1-yl(phenyl)phosphoryl]phenyl]phenyl]-phenylphosphoryl]naphthalene (PubChem CID 46939365) has the molecular formula C46H36O4P2 and a molecular weight of 714.74 g/mol. Its IUPAC name is 1-[[3-methoxy-2-[2-methoxy-6-[naphthalen-1-yl(phenyl)phosphoryl]phenyl]phenyl]-phenylphosphoryl]naphthalene.
| Compound Name | 1-[[3-methoxy-2-[2-methoxy-6-[naphthalen-1-yl(phenyl)phosphoryl]phenyl]phenyl]-phenylphosphoryl]naphthalene |
|---|---|
| PubChem CID | 46939365 |
| Molecular Formula | C46H36O4P2 |
| Molecular Weight | 714.74 g/mol |
| Exact Mass | 714.21 |
| IUPAC Name | 1-[[3-methoxy-2-[2-methoxy-6-[naphthalen-1-yl(phenyl)phosphoryl]phenyl]phenyl]-phenylphosphoryl]naphthalene |
| SMILES | COc1cccc([P@](=O)(c2ccccc2)c2cccc3ccccc23)c1-c1c(OC)cccc1[P@](=O)(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C46H36O4P2/c1-49-39-27-15-31-43(51(47,35-21-5-3-6-22-35)41-29-13-19-33-17-9-11-25-37(33)41)45(39)46-40(50-2)28-16-32-44(46)52(48,36-23-7-4-8-24-36)42-30-14-20-34-18-10-12-26-38(34)42/h3-32H,1-2H3/t51-,52-/m0/s1 |
| InChIKey | CMOUUIVABGWECX-XWQGWOARSA-N |
| XLogP | 8.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.74 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|