C17H18O3 — CID 154722868
2-deuterio-3-(2,6-dimethoxyphenyl)-1-phenylpropan-1-one (PubChem CID 154722868) has the molecular formula C17H18O3 and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-deuterio-3-(2,6-dimethoxyphenyl)-1-phenylpropan-1-one.
| Compound Name | 2-deuterio-3-(2,6-dimethoxyphenyl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 154722868 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-deuterio-3-(2,6-dimethoxyphenyl)-1-phenylpropan-1-one |
| SMILES | [2H]C(Cc1c(OC)cccc1OC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O3/c1-19-16-9-6-10-17(20-2)14(16)11-12-15(18)13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3/i12D |
| InChIKey | YYJOCQBAQAMNPV-UQBWLURTSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |