C17H16O3 — CID 11459858
2-methoxy-1,4-diphenylbutane-1,4-dione (PubChem CID 11459858) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-methoxy-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2-methoxy-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 11459858 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-methoxy-1,4-diphenylbutane-1,4-dione |
| SMILES | COC(CC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O3/c1-20-16(17(19)14-10-6-3-7-11-14)12-15(18)13-8-4-2-5-9-13/h2-11,16H,12H2,1H3 |
| InChIKey | BGPVSQJHLAYJDD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |