C13H18O — CID 24976524
3,4-dimethyl-1-phenylpentan-1-one (PubChem CID 24976524) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 3,4-dimethyl-1-phenylpentan-1-one.
| Compound Name | 3,4-dimethyl-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 24976524 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 3,4-dimethyl-1-phenylpentan-1-one |
| SMILES | CC(C)C(C)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O/c1-10(2)11(3)9-13(14)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | MEGULPTYCJHQBK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |