C20H32O2 — CID 174883238
2,6-dimethylheptan-4-one;3-methyl-1-phenylbutan-1-one (PubChem CID 174883238) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-one;3-methyl-1-phenylbutan-1-one.
| Compound Name | 2,6-dimethylheptan-4-one;3-methyl-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 174883238 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2,6-dimethylheptan-4-one;3-methyl-1-phenylbutan-1-one |
| SMILES | CC(C)CC(=O)CC(C)C.CC(C)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O.C9H18O/c1-9(2)8-11(12)10-6-4-3-5-7-10;1-7(2)5-9(10)6-8(3)4/h3-7,9H,8H2,1-2H3;7-8H,5-6H2,1-4H3 |
| InChIKey | TZRCRHKIZMUWPT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |