About S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate
S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate (PubChem CID 122700215) has the molecular formula C14H18O2S
and a molecular weight of 250.36 g/mol. Its IUPAC name is S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate.
Molecular Properties
| Compound Name | S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate |
| PubChem CID | 122700215 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate |
| SMILES | CC(C)CC(=O)SCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c1-11(2)10-14(16)17-9-8-13(15)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | MZDNCVCBSLNOGC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate?
The IUPAC name of S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate (CID 122700215) is S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate.
What is the SMILES notation for S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate?
The canonical SMILES for S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate is CC(C)CC(=O)SCCC(=O)c1ccccc1.
What is the InChIKey of S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate?
The InChIKey is MZDNCVCBSLNOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2S/c1-11(2)10-14(16)17-9-8-13(15)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3.
What are the key properties of S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate?
S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate has a molecular weight of 250.36 g/mol, XLogP of 3.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-oxo-3-phenylpropyl) 3-methylbutanethioate is sourced from PubChem (CID 122700215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).