About (3-oxo-3-phenylpropyl) thiohypobromite
(3-oxo-3-phenylpropyl) thiohypobromite (PubChem CID 141050079) has the molecular formula C9H9BrOS
and a molecular weight of 245.14 g/mol. Its IUPAC name is (3-oxo-3-phenylpropyl) thiohypobromite.
Molecular Properties
| Compound Name | (3-oxo-3-phenylpropyl) thiohypobromite |
| PubChem CID | 141050079 |
| Molecular Formula | C9H9BrOS |
| Molecular Weight | 245.14 g/mol |
| Exact Mass | 243.96 |
| IUPAC Name | (3-oxo-3-phenylpropyl) thiohypobromite |
| SMILES | O=C(CCSBr)c1ccccc1 |
| InChI | InChI=1S/C9H9BrOS/c10-12-7-6-9(11)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | QHSWRTMHCOUYBS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.14 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-oxo-3-phenylpropyl) thiohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-3-phenylpropyl) thiohypobromite?
The IUPAC name of (3-oxo-3-phenylpropyl) thiohypobromite (CID 141050079) is (3-oxo-3-phenylpropyl) thiohypobromite.
What is the SMILES notation for (3-oxo-3-phenylpropyl) thiohypobromite?
The canonical SMILES for (3-oxo-3-phenylpropyl) thiohypobromite is O=C(CCSBr)c1ccccc1.
What is the InChIKey of (3-oxo-3-phenylpropyl) thiohypobromite?
The InChIKey is QHSWRTMHCOUYBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrOS/c10-12-7-6-9(11)8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of (3-oxo-3-phenylpropyl) thiohypobromite?
(3-oxo-3-phenylpropyl) thiohypobromite has a molecular weight of 245.14 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-3-phenylpropyl) thiohypobromite is sourced from PubChem (CID 141050079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).