C12H14O3 — CID 102259650
5-hydroxy-1-phenylhexane-1,4-dione (PubChem CID 102259650) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-hydroxy-1-phenylhexane-1,4-dione.
| Compound Name | 5-hydroxy-1-phenylhexane-1,4-dione |
|---|---|
| PubChem CID | 102259650 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-hydroxy-1-phenylhexane-1,4-dione |
| SMILES | CC(O)C(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-9(13)11(14)7-8-12(15)10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3 |
| InChIKey | GCCBYMLXMUUOHS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |