C16H22O4S — CID 101123075
(Z,3S,6R)-3-methoxy-4-methyl-6-methylsulfonyl-1-phenylhept-4-en-1-one (PubChem CID 101123075) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is (Z,3S,6R)-3-methoxy-4-methyl-6-methylsulfonyl-1-phenylhept-4-en-1-one.
| Compound Name | (Z,3S,6R)-3-methoxy-4-methyl-6-methylsulfonyl-1-phenylhept-4-en-1-one |
|---|---|
| PubChem CID | 101123075 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (Z,3S,6R)-3-methoxy-4-methyl-6-methylsulfonyl-1-phenylhept-4-en-1-one |
| SMILES | CO[C@@H](CC(=O)c1ccccc1)/C(C)=C\[C@@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C16H22O4S/c1-12(10-13(2)21(4,18)19)16(20-3)11-15(17)14-8-6-5-7-9-14/h5-10,13,16H,11H2,1-4H3/b12-10-/t13-,16+/m1/s1 |
| InChIKey | GFBSASBHOLXSHJ-CEXFEBICSA-N |
| XLogP | 2.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|