C19H30O4SSi — CID 11153277
(Z,4R,7S)-5-methyl-4-phenylmethoxy-7-trimethylsilylsulfonyloct-5-en-2-one (PubChem CID 11153277) has the molecular formula C19H30O4SSi and a molecular weight of 382.60 g/mol. Its IUPAC name is (Z,4R,7S)-5-methyl-4-phenylmethoxy-7-trimethylsilylsulfonyloct-5-en-2-one.
| Compound Name | (Z,4R,7S)-5-methyl-4-phenylmethoxy-7-trimethylsilylsulfonyloct-5-en-2-one |
|---|---|
| PubChem CID | 11153277 |
| Molecular Formula | C19H30O4SSi |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (Z,4R,7S)-5-methyl-4-phenylmethoxy-7-trimethylsilylsulfonyloct-5-en-2-one |
| SMILES | CC(=O)C[C@@H](OCc1ccccc1)/C(C)=C\[C@H](C)S(=O)(=O)[Si](C)(C)C |
| InChI | InChI=1S/C19H30O4SSi/c1-15(12-17(3)24(21,22)25(4,5)6)19(13-16(2)20)23-14-18-10-8-7-9-11-18/h7-12,17,19H,13-14H2,1-6H3/b15-12-/t17-,19+/m0/s1 |
| InChIKey | SOXBEAXWHUOIHU-ZWBWRASZSA-N |
| XLogP | 4.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|