C20H30O4S — CID 101123087
(E,5S,8S)-2,2,6-trimethyl-8-methylsulfonyl-5-phenylmethoxynon-6-en-3-one (PubChem CID 101123087) has the molecular formula C20H30O4S and a molecular weight of 366.52 g/mol. Its IUPAC name is (E,5S,8S)-2,2,6-trimethyl-8-methylsulfonyl-5-phenylmethoxynon-6-en-3-one.
| Compound Name | (E,5S,8S)-2,2,6-trimethyl-8-methylsulfonyl-5-phenylmethoxynon-6-en-3-one |
|---|---|
| PubChem CID | 101123087 |
| Molecular Formula | C20H30O4S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (E,5S,8S)-2,2,6-trimethyl-8-methylsulfonyl-5-phenylmethoxynon-6-en-3-one |
| SMILES | C/C(=C\[C@H](C)S(C)(=O)=O)[C@H](CC(=O)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C20H30O4S/c1-15(12-16(2)25(6,22)23)18(13-19(21)20(3,4)5)24-14-17-10-8-7-9-11-17/h7-12,16,18H,13-14H2,1-6H3/b15-12+/t16-,18-/m0/s1 |
| InChIKey | GZJTVSWVXPAVSJ-QUJHGWJTSA-N |
| XLogP | 3.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|