C20H32O3 — CID 11045443
(5S,6S,7S)-5-hydroxy-2,2,6,8-tetramethyl-7-phenylmethoxynonan-3-one (PubChem CID 11045443) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (5S,6S,7S)-5-hydroxy-2,2,6,8-tetramethyl-7-phenylmethoxynonan-3-one.
| Compound Name | (5S,6S,7S)-5-hydroxy-2,2,6,8-tetramethyl-7-phenylmethoxynonan-3-one |
|---|---|
| PubChem CID | 11045443 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (5S,6S,7S)-5-hydroxy-2,2,6,8-tetramethyl-7-phenylmethoxynonan-3-one |
| SMILES | CC(C)[C@H](OCc1ccccc1)[C@@H](C)[C@@H](O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H32O3/c1-14(2)19(23-13-16-10-8-7-9-11-16)15(3)17(21)12-18(22)20(4,5)6/h7-11,14-15,17,19,21H,12-13H2,1-6H3/t15-,17-,19-/m0/s1 |
| InChIKey | KRONGDZVQNZMKI-IEZWGBDMSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |