C15H22O3 — CID 102255359
(4S,5R)-4-hydroxy-6-methyl-5-phenylmethoxyheptan-2-one (PubChem CID 102255359) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (4S,5R)-4-hydroxy-6-methyl-5-phenylmethoxyheptan-2-one.
| Compound Name | (4S,5R)-4-hydroxy-6-methyl-5-phenylmethoxyheptan-2-one |
|---|---|
| PubChem CID | 102255359 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4S,5R)-4-hydroxy-6-methyl-5-phenylmethoxyheptan-2-one |
| SMILES | CC(=O)C[C@H](O)[C@H](OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C15H22O3/c1-11(2)15(14(17)9-12(3)16)18-10-13-7-5-4-6-8-13/h4-8,11,14-15,17H,9-10H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | BJPDMWVXLFJNFK-LSDHHAIUSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |