C12H13Cl3O2 — CID 23726238
5,5,5-trichloro-4-phenylmethoxypentan-2-one (PubChem CID 23726238) has the molecular formula C12H13Cl3O2 and a molecular weight of 295.59 g/mol. Its IUPAC name is 5,5,5-trichloro-4-phenylmethoxypentan-2-one.
| Compound Name | 5,5,5-trichloro-4-phenylmethoxypentan-2-one |
|---|---|
| PubChem CID | 23726238 |
| Molecular Formula | C12H13Cl3O2 |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 5,5,5-trichloro-4-phenylmethoxypentan-2-one |
| SMILES | CC(=O)CC(OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl3O2/c1-9(16)7-11(12(13,14)15)17-8-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3 |
| InChIKey | FLCPWZCRBTWFPX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|