C17H22O3 — CID 158311218
(6S,7S)-7-methyl-6-phenylmethoxynon-8-ene-2,4-dione (PubChem CID 158311218) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (6S,7S)-7-methyl-6-phenylmethoxynon-8-ene-2,4-dione.
| Compound Name | (6S,7S)-7-methyl-6-phenylmethoxynon-8-ene-2,4-dione |
|---|---|
| PubChem CID | 158311218 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (6S,7S)-7-methyl-6-phenylmethoxynon-8-ene-2,4-dione |
| SMILES | C=C[C@H](C)[C@H](CC(=O)CC(C)=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22O3/c1-4-13(2)17(11-16(19)10-14(3)18)20-12-15-8-6-5-7-9-15/h4-9,13,17H,1,10-12H2,2-3H3/t13-,17-/m0/s1 |
| InChIKey | GNIZTTFQYJKHKO-GUYCJALGSA-N |
| XLogP | 3.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|