About 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium
2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium (PubChem CID 157458679) has the molecular formula C11H12O4V
and a molecular weight of 259.16 g/mol. Its IUPAC name is 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium.
Molecular Properties
| Compound Name | 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium |
| PubChem CID | 157458679 |
| Molecular Formula | C11H12O4V |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium |
| SMILES | COC(CC(=O)c1ccccc1)C(=O)O.[V] |
| InChI | InChI=1S/C11H12O4.V/c1-15-10(11(13)14)7-9(12)8-5-3-2-4-6-8;/h2-6,10H,7H2,1H3,(H,13,14); |
| InChIKey | BTQXTNLIXNQRNQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium?
The IUPAC name of 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium (CID 157458679) is 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium.
What is the SMILES notation for 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium?
The canonical SMILES for 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium is COC(CC(=O)c1ccccc1)C(=O)O.[V].
What is the InChIKey of 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium?
The InChIKey is BTQXTNLIXNQRNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4.V/c1-15-10(11(13)14)7-9(12)8-5-3-2-4-6-8;/h2-6,10H,7H2,1H3,(H,13,14);.
What are the key properties of 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium?
2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium has a molecular weight of 259.16 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-oxo-4-phenylbutanoic acid;vanadium is sourced from PubChem (CID 157458679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).