C12H12Cl2O4 — CID 13420313
4-(3,5-dichloro-4-methylphenyl)-2-methoxy-4-oxobutanoic acid (PubChem CID 13420313) has the molecular formula C12H12Cl2O4 and a molecular weight of 291.13 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-methylphenyl)-2-methoxy-4-oxobutanoic acid.
| Compound Name | 4-(3,5-dichloro-4-methylphenyl)-2-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 13420313 |
| Molecular Formula | C12H12Cl2O4 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 4-(3,5-dichloro-4-methylphenyl)-2-methoxy-4-oxobutanoic acid |
| SMILES | COC(CC(=O)c1cc(Cl)c(C)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H12Cl2O4/c1-6-8(13)3-7(4-9(6)14)10(15)5-11(18-2)12(16)17/h3-4,11H,5H2,1-2H3,(H,16,17) |
| InChIKey | BZFCRJZEVUXHPI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |