C23H21NO3 — CID 11760150
2-(2-methoxyanilino)-1,4-diphenylbutane-1,4-dione (PubChem CID 11760150) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2-(2-methoxyanilino)-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 11760150 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-(2-methoxyanilino)-1,4-diphenylbutane-1,4-dione |
| SMILES | COc1ccccc1NC(CC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO3/c1-27-22-15-9-8-14-19(22)24-20(23(26)18-12-6-3-7-13-18)16-21(25)17-10-4-2-5-11-17/h2-15,20,24H,16H2,1H3 |
| InChIKey | JWTJZLNDLQIWRL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |