C25H24ClO5P — CID 18514546
(2-chloro-6-methylphenyl)-[(2,6-diethoxybenzoyl)-phenylphosphoryl]methanone (PubChem CID 18514546) has the molecular formula C25H24ClO5P and a molecular weight of 470.89 g/mol. Its IUPAC name is (2-chloro-6-methylphenyl)-[(2,6-diethoxybenzoyl)-phenylphosphoryl]methanone.
| Compound Name | (2-chloro-6-methylphenyl)-[(2,6-diethoxybenzoyl)-phenylphosphoryl]methanone |
|---|---|
| PubChem CID | 18514546 |
| Molecular Formula | C25H24ClO5P |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (2-chloro-6-methylphenyl)-[(2,6-diethoxybenzoyl)-phenylphosphoryl]methanone |
| SMILES | CCOc1cccc(OCC)c1C(=O)P(=O)(C(=O)c1c(C)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C25H24ClO5P/c1-4-30-20-15-10-16-21(31-5-2)23(20)25(28)32(29,18-12-7-6-8-13-18)24(27)22-17(3)11-9-14-19(22)26/h6-16H,4-5H2,1-3H3 |
| InChIKey | URELWLRGMLYAJQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|