C20H12Cl3O3P — CID 141016789
phenyl-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone (PubChem CID 141016789) has the molecular formula C20H12Cl3O3P and a molecular weight of 437.65 g/mol. Its IUPAC name is phenyl-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone.
| Compound Name | phenyl-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 141016789 |
| Molecular Formula | C20H12Cl3O3P |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | phenyl-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone |
| SMILES | O=C(c1ccccc1)P(=O)(C(=O)c1c(Cl)ccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H12Cl3O3P/c21-15-11-12-16(22)18(23)17(15)20(25)27(26,14-9-5-2-6-10-14)19(24)13-7-3-1-4-8-13/h1-12H |
| InChIKey | SMEUGMCDFXNMMV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|