C23H15Cl2O2P — CID 22639250
(1,3-dichloronaphthalen-2-yl)-diphenylphosphorylmethanone (PubChem CID 22639250) has the molecular formula C23H15Cl2O2P and a molecular weight of 425.25 g/mol. Its IUPAC name is (1,3-dichloronaphthalen-2-yl)-diphenylphosphorylmethanone.
| Compound Name | (1,3-dichloronaphthalen-2-yl)-diphenylphosphorylmethanone |
|---|---|
| PubChem CID | 22639250 |
| Molecular Formula | C23H15Cl2O2P |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | (1,3-dichloronaphthalen-2-yl)-diphenylphosphorylmethanone |
| SMILES | O=C(c1c(Cl)cc2ccccc2c1Cl)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H15Cl2O2P/c24-20-15-16-9-7-8-14-19(16)22(25)21(20)23(26)28(27,17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-15H |
| InChIKey | URXFJDSHXFLNPE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|