C26H29O2P — CID 142409152
(3,5-diethyl-2,4,6-trimethylphenyl)-diphenylphosphorylmethanone (PubChem CID 142409152) has the molecular formula C26H29O2P and a molecular weight of 404.49 g/mol. Its IUPAC name is (3,5-diethyl-2,4,6-trimethylphenyl)-diphenylphosphorylmethanone.
| Compound Name | (3,5-diethyl-2,4,6-trimethylphenyl)-diphenylphosphorylmethanone |
|---|---|
| PubChem CID | 142409152 |
| Molecular Formula | C26H29O2P |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (3,5-diethyl-2,4,6-trimethylphenyl)-diphenylphosphorylmethanone |
| SMILES | CCc1c(C)c(CC)c(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C26H29O2P/c1-6-23-18(3)24(7-2)20(5)25(19(23)4)26(27)29(28,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17H,6-7H2,1-5H3 |
| InChIKey | RFMSGOBUXJMNDM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|