C23H21O5P — CID 155081855
2-(3-diphenylphosphorylcarbonyl-2,4-dimethylphenoxy)acetic acid (PubChem CID 155081855) has the molecular formula C23H21O5P and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-(3-diphenylphosphorylcarbonyl-2,4-dimethylphenoxy)acetic acid.
| Compound Name | 2-(3-diphenylphosphorylcarbonyl-2,4-dimethylphenoxy)acetic acid |
|---|---|
| PubChem CID | 155081855 |
| Molecular Formula | C23H21O5P |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-(3-diphenylphosphorylcarbonyl-2,4-dimethylphenoxy)acetic acid |
| SMILES | Cc1ccc(OCC(=O)O)c(C)c1C(=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21O5P/c1-16-13-14-20(28-15-21(24)25)17(2)22(16)23(26)29(27,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14H,15H2,1-2H3,(H,24,25) |
| InChIKey | RKCRWPVLFGPSRI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|