C26H28NO4P — CID 177063113
N-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-ethoxyacetamide (PubChem CID 177063113) has the molecular formula C26H28NO4P and a molecular weight of 449.49 g/mol. Its IUPAC name is N-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-ethoxyacetamide.
| Compound Name | N-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 177063113 |
| Molecular Formula | C26H28NO4P |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-ethoxyacetamide |
| SMILES | CCOCC(=O)Nc1c(C)cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C26H28NO4P/c1-5-31-17-23(28)27-25-19(3)16-18(2)24(20(25)4)26(29)32(30,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-16H,5,17H2,1-4H3,(H,27,28) |
| InChIKey | FZTHDJBAVFOPMS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|