C81H69O15P3 — CID 140903590
tris[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-oxoethyl] benzene-1,3,5-tricarboxylate (PubChem CID 140903590) has the molecular formula C81H69O15P3 and a molecular weight of 1375.35 g/mol. Its IUPAC name is tris[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-oxoethyl] benzene-1,3,5-tricarboxylate.
| Compound Name | tris[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-oxoethyl] benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 140903590 |
| Molecular Formula | C81H69O15P3 |
| Molecular Weight | 1375.35 g/mol |
| Exact Mass | 1374.38 |
| IUPAC Name | tris[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenyl)-2-oxoethyl] benzene-1,3,5-tricarboxylate |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1C(=O)COC(=O)c1cc(C(=O)OCC(=O)c2c(C)cc(C)c(C(=O)P(=O)(c3ccccc3)c3ccccc3)c2C)cc(C(=O)OCC(=O)c2c(C)cc(C)c(C(=O)P(=O)(c3ccccc3)c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C81H69O15P3/c1-49-40-52(4)73(79(88)97(91,61-28-16-10-17-29-61)62-30-18-11-19-31-62)55(7)70(49)67(82)46-94-76(85)58-43-59(77(86)95-47-68(83)71-50(2)41-53(5)74(56(71)8)80(89)98(92,63-32-20-12-21-33-63)64-34-22-13-23-35-64)45-60(44-58)78(87)96-48-69(84)72-51(3)42-54(6)75(57(72)9)81(90)99(93,65-36-24-14-25-37-65)66-38-26-15-27-39-66/h10-45H,46-48H2,1-9H3 |
| InChIKey | RQBZZKJKWKGMAE-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 232.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 99 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1375.35 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|