C25H25O4P — CID 118237088
[3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]-phenylmethanone (PubChem CID 118237088) has the molecular formula C25H25O4P and a molecular weight of 420.45 g/mol. Its IUPAC name is [3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]-phenylmethanone.
| Compound Name | [3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 118237088 |
| Molecular Formula | C25H25O4P |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [3-[ethoxy(phenyl)phosphoryl]carbonyl-2,4,6-trimethylphenyl]-phenylmethanone |
| SMILES | CCOP(=O)(C(=O)c1c(C)cc(C)c(C(=O)c2ccccc2)c1C)c1ccccc1 |
| InChI | InChI=1S/C25H25O4P/c1-5-29-30(28,21-14-10-7-11-15-21)25(27)23-18(3)16-17(2)22(19(23)4)24(26)20-12-8-6-9-13-20/h6-16H,5H2,1-4H3 |
| InChIKey | DMEKIRJYJZTAGQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|