C23H21O3P — CID 5475891
(Z)-2-[ethoxy(phenyl)phosphoryl]-1,3-diphenylprop-2-en-1-one (PubChem CID 5475891) has the molecular formula C23H21O3P and a molecular weight of 376.39 g/mol. Its IUPAC name is (Z)-2-[ethoxy(phenyl)phosphoryl]-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-2-[ethoxy(phenyl)phosphoryl]-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5475891 |
| Molecular Formula | C23H21O3P |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (Z)-2-[ethoxy(phenyl)phosphoryl]-1,3-diphenylprop-2-en-1-one |
| SMILES | CCOP(=O)(/C(=C\c1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21O3P/c1-2-26-27(25,21-16-10-5-11-17-21)22(18-19-12-6-3-7-13-19)23(24)20-14-8-4-9-15-20/h3-18H,2H2,1H3/b22-18- |
| InChIKey | BCAMRFNQIJGXMZ-PYCFMQQDSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|